CAS 1249152-29-1 appears in our catalog under these names: 1-[(4-Bromophenyl)methyl]-3,5-dimethyl-1h-pyrazole, 95%, 1-((4-Bromophenyl)methyl)-3,5-dimethyl-1H-pyrazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazole (CAS 1249152-29-1) is a chemical compound with the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. IUPAC name: 1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazole. InChIKey: TXDPBRCODGKEKX-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2 |
|---|---|
| Molecular weight | 265.15 g/mol |
| IUPAC name | 1-[(4-bromophenyl)methyl]-3,5-dimethylpyrazole |
| InChIKey | TXDPBRCODGKEKX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)