CAS 1598488-42-6 is the registry number for 2-(4-Bromo-3,5-dimethylphenyl)-5-methyl-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromo-3,5-dimethylphenyl)-5-methyl-1H-imidazole (CAS 1598488-42-6) is a chemical compound with the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. IUPAC name: 2-(4-bromo-3,5-dimethylphenyl)-5-methyl-1H-imidazole. InChIKey: AVFSNTMWGMIMCN-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2 |
|---|---|
| Molecular weight | 265.15 g/mol |
| IUPAC name | 2-(4-bromo-3,5-dimethylphenyl)-5-methyl-1H-imidazole |
| InChIKey | AVFSNTMWGMIMCN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C2=NC=C(N2)C |
Computed by PubChem (NCBI)