cas: 842169-72-6 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride 95% (CAS 842169-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A542449-100mg |
| cas | 842169-72-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 882.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A542449 |
1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 842169-72-6) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: XESDERGPILUSRV-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | XESDERGPILUSRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)Br.Cl |
Computed by PubChem (NCBI)