cas: 842169-72-6 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 98% (CAS 842169-72-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 50mg, 100mg, 500mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QM-5712-1g |
| cas | 842169-72-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 50mg | 232.23 Pln | |
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 500mg | 752.88 Pln | |
| Fluorochem | 1g | 1002.79 Pln | |
| Fluorochem | 5g | 3637.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 842169-72-6) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: XESDERGPILUSRV-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | XESDERGPILUSRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)Br.Cl |
Computed by PubChem (NCBI)