cas: 5044-24-6 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-2,5-dimethyl-1H-pyrrole 98% (CAS 5044-24-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A410941-1g |
| cas | 5044-24-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 25g | 1282.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A410941 |
1-(4-bromophenyl)-2,5-dimethylpyrrole (CAS 5044-24-6) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 1-(4-bromophenyl)-2,5-dimethylpyrrole. InChIKey: OURHFEVMTCZQLA-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,5-dimethylpyrrole |
| InChIKey | OURHFEVMTCZQLA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)