1-(4-Bromophenyl)-2,5-dimethyl-1H-pyrrole, 98%
cas: 5044-24-6 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-2,5-dimethyl-1H-pyrrole, 98% (CAS 5044-24-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A410941-1g |
| cas | 5044-24-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 492.75 Pln | |
| Ambeed | 25g | 1293.75 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 496.40 Pln | |
| Chemat | 25g | 2205.20 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 525.40 Pln | |
| BLDpharm | 25g | 1386.20 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 903.87 Pln | |
| Fluorochem | 25g | 4079.83 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-bromophenyl)-2,5-dimethylpyrrole (CAS 5044-24-6) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 1-(4-bromophenyl)-2,5-dimethylpyrrole. InChIKey: OURHFEVMTCZQLA-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,5-dimethylpyrrole |
| InChIKey | OURHFEVMTCZQLA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)