cas: 4559-96-0 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-4-chlorobutan-1-one, 96% (CAS 4559-96-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239667-1G |
| cas | 4559-96-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 10g | 221.81 Pln | |
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 100g | 1294.35 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-bromophenyl)-4-chlorobutan-1-one (CAS 4559-96-0) is a chemical compound with the molecular formula C10H10BrClO and a molecular weight of 261.54 g/mol. IUPAC name: 1-(4-bromophenyl)-4-chlorobutan-1-one. InChIKey: WJKPUMBLABGUCQ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO |
|---|---|
| Molecular weight | 261.54 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4-chlorobutan-1-one |
| InChIKey | WJKPUMBLABGUCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCCCl)Br |
Computed by PubChem (NCBI)