CAS 1344243-82-8 appears in our catalog under these names: 1-(4-Bromo-2,5-dimethylphenyl)-2-chloroethan-1-one, 95%, 1-(4-Bromo-2,5-dimethylphenyl)-2-chloroethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(4-bromo-2,5-dimethylphenyl)-2-chloroethanone (CAS 1344243-82-8) is a chemical compound with the molecular formula C10H10BrClO and a molecular weight of 261.54 g/mol. IUPAC name: 1-(4-bromo-2,5-dimethylphenyl)-2-chloroethanone. InChIKey: UKKVHDILPSUAOB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO |
|---|---|
| Molecular weight | 261.54 g/mol |
| IUPAC name | 1-(4-bromo-2,5-dimethylphenyl)-2-chloroethanone |
| InChIKey | UKKVHDILPSUAOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)C(=O)CCl |
Computed by PubChem (NCBI)