CAS 143327-55-3 is the registry number for 1-Bromo-4-(4-chlorophenyl)butan-2-one. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
1-bromo-4-(4-chlorophenyl)butan-2-one (CAS 143327-55-3) is a chemical compound with the molecular formula C10H10BrClO and a molecular weight of 261.54 g/mol. IUPAC name: 1-bromo-4-(4-chlorophenyl)butan-2-one. InChIKey: QHIPMIUCKDMPEK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO |
|---|---|
| Molecular weight | 261.54 g/mol |
| IUPAC name | 1-bromo-4-(4-chlorophenyl)butan-2-one |
| InChIKey | QHIPMIUCKDMPEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(=O)CBr)Cl |
Computed by PubChem (NCBI)