CAS 1011-26-3 appears in our catalog under these names: 2–Bromo–1–(4–chlorophenyl)butan–1–one, 2-Bromo-1-(4-chlorophenyl)butan-1-one. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 2,5g.
2-bromo-4-chloro-1-phenylbutan-1-one (CAS 1011-26-3) is a chemical compound with the molecular formula C10H10BrClO and a molecular weight of 261.54 g/mol. IUPAC name: 2-bromo-4-chloro-1-phenylbutan-1-one. InChIKey: BZCCCSNXGHGIEF-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO |
|---|---|
| Molecular weight | 261.54 g/mol |
| IUPAC name | 2-bromo-4-chloro-1-phenylbutan-1-one |
| InChIKey | BZCCCSNXGHGIEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(CCCl)Br |
Computed by PubChem (NCBI)