CAS 33000-64-5 is the registry number for 2–Bromo–1–(4–chlorophenyl)–2–methylpropan–1–one. Offered by: GLPBio. Available pack sizes: 100mg.
2-bromo-1-(4-chlorophenyl)-2-methylpropan-1-one (CAS 33000-64-5) is a chemical compound with the molecular formula C10H10BrClO and a molecular weight of 261.54 g/mol. IUPAC name: 2-bromo-1-(4-chlorophenyl)-2-methylpropan-1-one. InChIKey: IZEYISCHXYIBBQ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO |
|---|---|
| Molecular weight | 261.54 g/mol |
| IUPAC name | 2-bromo-1-(4-chlorophenyl)-2-methylpropan-1-one |
| InChIKey | IZEYISCHXYIBBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)C1=CC=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)