cas: 66346-01-8 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-4,4-dimethylpentan-3-one 97% (CAS 66346-01-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A298270-25g |
| cas | 66346-01-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 398.19 Pln | |
| Ambeed | 500g | 1060.12 Pln | |
| Ambeed | 1000g | 1805.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A298270 |
1-(4-chlorophenyl)-4,4-dimethylpentan-3-one (CAS 66346-01-8) is a chemical compound with the molecular formula C13H17ClO and a molecular weight of 224.72 g/mol. IUPAC name: 1-(4-chlorophenyl)-4,4-dimethylpentan-3-one. InChIKey: ILQGIJDYSLHIOX-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO |
|---|---|
| Molecular weight | 224.72 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-4,4-dimethylpentan-3-one |
| InChIKey | ILQGIJDYSLHIOX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CCC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)