CAS 1019398-59-4 is the registry number for Ibuprofen Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-butan-2-ylphenyl)-2-chloropropan-1-one (CAS 1019398-59-4) is a chemical compound with the molecular formula C13H17ClO and a molecular weight of 224.72 g/mol. IUPAC name: 1-(4-butan-2-ylphenyl)-2-chloropropan-1-one. InChIKey: UWIZAUHXEPVHSO-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO |
|---|---|
| Molecular weight | 224.72 g/mol |
| IUPAC name | 1-(4-butan-2-ylphenyl)-2-chloropropan-1-one |
| InChIKey | UWIZAUHXEPVHSO-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=CC=C(C=C1)C(=O)C(C)Cl |
Computed by PubChem (NCBI)