CAS 115588-20-0 is the registry number for (S)-(+)-Ibuprofen Acid Chloride. Offered by: TRC. Available pack sizes: 25mg.
(2S)-2-[4-(2-methylpropyl)phenyl]propanoyl chloride (CAS 115588-20-0) is a chemical compound with the molecular formula C13H17ClO and a molecular weight of 224.72 g/mol. IUPAC name: (2S)-2-[4-(2-methylpropyl)phenyl]propanoyl chloride. InChIKey: QXVRLFIKHYCFJS-JTQLQIEISA-N.
| Molecular formula | C13H17ClO |
|---|---|
| Molecular weight | 224.72 g/mol |
| IUPAC name | (2S)-2-[4-(2-methylpropyl)phenyl]propanoyl chloride |
| InChIKey | QXVRLFIKHYCFJS-JTQLQIEISA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)CC(C)C)C(=O)Cl |
Computed by PubChem (NCBI)