cas: 1009102-44-6 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)cyclopropanamine hydrochloride 97% (CAS 1009102-44-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A284116-250mg |
| cas | 1009102-44-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1238.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A284116 |
1-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1009102-44-6) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: UQTQBRJXTQDWHY-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | UQTQBRJXTQDWHY-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)