CAS 1156491-06-3 is the registry number for (1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Trans-(1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1156491-06-3) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: trans-(1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: QRDJNIKTHWYMIN-OULXEKPRSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | QRDJNIKTHWYMIN-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)