CAS 1191908-38-9 appears in our catalog under these names: 6-Chloro-2,3-dihydro-1h-inden-1-amine hydrochloride, 97%, 6-Chloroindan-1-amine hydrochloride, 6-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%, 98%, 6-Chloroindan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1191908-38-9) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 6-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: OCGZLBIOLHMGRO-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 6-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | OCGZLBIOLHMGRO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)