CAS 1428234-45-0 is the registry number for 2,6-Dichloro-4-isopropylaniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2,6-dichloro-4-propan-2-ylaniline (CAS 1428234-45-0) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 2,6-dichloro-4-propan-2-ylaniline. InChIKey: YWZJMEWPEZRBTL-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 2,6-dichloro-4-propan-2-ylaniline |
| InChIKey | YWZJMEWPEZRBTL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Cl)N)Cl |
Computed by PubChem (NCBI)