CAS 1197668-23-7 appears in our catalog under these names: 5-Chloro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, 5–Chloro–2,3–dihydro–1H–inden–1–amine Hydrochloride, 5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%, 98%, 5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg, 2,5g, 500mg, 5g.
5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1197668-23-7) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: JRYBHXVWIQBARN-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | JRYBHXVWIQBARN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC(=C2)Cl.Cl |
Computed by PubChem (NCBI)