cas: 38212-33-8 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)piperazine, ≥98%, ≥98% (CAS 38212-33-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8IY-1g |
| cas | 38212-33-8 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 100g | 813.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1-(4-chlorophenyl)piperazine (CAS 38212-33-8) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 1-(4-chlorophenyl)piperazine. InChIKey: UNEIHNMKASENIG-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 1-(4-chlorophenyl)piperazine |
| InChIKey | UNEIHNMKASENIG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)