cas: 1060809-07-5 — see every product listed under this CAS number, including other names
1-(4-Chloropyridin-2-yl)-2,2,2-trifluoroethanamine 95% (CAS 1060809-07-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A809161-50mg |
| cas | 1060809-07-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 342.56 Pln | |
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1583.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A809161 |
1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine (CAS 1060809-07-5) is a chemical compound with the molecular formula C7H6ClF3N2 and a molecular weight of 210.58 g/mol. IUPAC name: 1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine. InChIKey: DHJAKRJDZPEGQU-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF3N2 |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine |
| InChIKey | DHJAKRJDZPEGQU-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(C(F)(F)F)N |
Computed by PubChem (NCBI)