cas: 1060809-07-5 — see every product listed under this CAS number, including other names
1-(4-Chloropyridin-2-yl)-2,2,2-trifluoroethanamine, 95%, 95% (CAS 1060809-07-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUP2-1g |
| cas | 1060809-07-5 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1715.60 Pln | |
| Chemat | 50mg | 323.60 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 674.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine (CAS 1060809-07-5) is a chemical compound with the molecular formula C7H6ClF3N2 and a molecular weight of 210.58 g/mol. IUPAC name: 1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine. InChIKey: DHJAKRJDZPEGQU-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF3N2 |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine |
| InChIKey | DHJAKRJDZPEGQU-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(C(F)(F)F)N |
Computed by PubChem (NCBI)