cas: 119516-86-8 — see every product listed under this CAS number, including other names
1-(4-Cyanophenyl)-2,5-dimethylpyrrole (CAS 119516-86-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IWX-1g |
| cas | 119516-86-8 |
| size | 1g |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 635.60 Pln |
| delivery time | 3 weeks |
|---|
4-(2,5-dimethylpyrrol-1-yl)benzonitrile (CAS 119516-86-8) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: 4-(2,5-dimethylpyrrol-1-yl)benzonitrile. InChIKey: FNDFKQYZEDOHRC-UHFFFAOYSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 4-(2,5-dimethylpyrrol-1-yl)benzonitrile |
| InChIKey | FNDFKQYZEDOHRC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=C(C=C2)C#N)C |
Computed by PubChem (NCBI)