CAS 176034-12-1 appears in our catalog under these names: 3-[(E)-2-Pyridin-2-ylvinyl]aniline, 95%, 3-((E)-2-Pyridin-2-ylvinyl)aniline, 3-[(E)-2-pyridin-2-ylvinyl]aniline. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 25g, 5g, 1g, 2,5g.
3-[(E)-2-pyridin-2-ylethenyl]aniline (CAS 176034-12-1) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: 3-[(E)-2-pyridin-2-ylethenyl]aniline. InChIKey: WVPUKLNVCMBNMD-BQYQJAHWSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 3-[(E)-2-pyridin-2-ylethenyl]aniline |
| InChIKey | WVPUKLNVCMBNMD-BQYQJAHWSA-N |
| SMILES | C1=CC=NC(=C1)/C=C/C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)