CAS 209798-50-5 is the registry number for 3-Pyridinamine, 2-(2-phenylethenyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
2-[(E)-2-phenylethenyl]pyridin-3-amine (CAS 209798-50-5) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: 2-[(E)-2-phenylethenyl]pyridin-3-amine. InChIKey: VXARDGMDMUMINC-CMDGGOBGSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 2-[(E)-2-phenylethenyl]pyridin-3-amine |
| InChIKey | VXARDGMDMUMINC-CMDGGOBGSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=C(C=CC=N2)N |
Computed by PubChem (NCBI)