CAS 204142-42-7 is the registry number for N-(3-Cyanophenyl)-2,5-dimethylpyrrole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
3-(2,5-dimethylpyrrol-1-yl)benzonitrile (CAS 204142-42-7) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: 3-(2,5-dimethylpyrrol-1-yl)benzonitrile. InChIKey: NBJROBAUWGQJGQ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 3-(2,5-dimethylpyrrol-1-yl)benzonitrile |
| InChIKey | NBJROBAUWGQJGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=CC(=C2)C#N)C |
Computed by PubChem (NCBI)