CAS 525-64-4 appears in our catalog under these names: 2,7-Diaminofluorene, 95%, 2,7–Diaminofluorene, 2,7-Diaminofluorene, 97% , 2,7-Diaminofluorene, >98.0%(HPLC), 2,7-Diamino-fluorene 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100mg.
9H-fluorene-2,7-diamine (CAS 525-64-4) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: 9H-fluorene-2,7-diamine. InChIKey: SNCJAJRILVFXAE-UHFFFAOYSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 9H-fluorene-2,7-diamine |
| InChIKey | SNCJAJRILVFXAE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N)C3=C1C=C(C=C3)N |
Computed by PubChem (NCBI)