cas: 941869-20-1 — see every product listed under this CAS number, including other names
1-(4-Fluorobenzyl)-6-oxo-1,6-dihydropyridine-3-carboxylic acid 93% (CAS 941869-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A657989-100mg |
| cas | 941869-20-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 359.25 Pln |
| purity | 93% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A657989 |
1-[(4-fluorophenyl)methyl]-6-oxopyridine-3-carboxylic acid (CAS 941869-20-1) is a chemical compound with the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]-6-oxopyridine-3-carboxylic acid. InChIKey: SCCIZPNWNADCEC-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO3 |
|---|---|
| Molecular weight | 247.22 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methyl]-6-oxopyridine-3-carboxylic acid |
| InChIKey | SCCIZPNWNADCEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C=CC2=O)C(=O)O)F |
Computed by PubChem (NCBI)