CAS 929000-81-7 is the registry number for 1-(4-Fluorophenyl)-5-methoxycarbonyl-2(1H)-pyridinone, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
Methyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate (CAS 929000-81-7) is a chemical compound with the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. IUPAC name: methyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate. InChIKey: MCRSIKGFABUVME-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO3 |
|---|---|
| Molecular weight | 247.22 g/mol |
| IUPAC name | methyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate |
| InChIKey | MCRSIKGFABUVME-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN(C(=O)C=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)