CAS 941867-91-0 appears in our catalog under these names: 4-(Benzyloxy)-1-fluoro-2-nitrobenzene, 97%, 4-(Benzyloxy)-1-fluoro-2-nitrobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
1-fluoro-2-nitro-4-phenylmethoxybenzene (CAS 941867-91-0) is a chemical compound with the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. IUPAC name: 1-fluoro-2-nitro-4-phenylmethoxybenzene. InChIKey: FWBDUAPLKFBELK-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO3 |
|---|---|
| Molecular weight | 247.22 g/mol |
| IUPAC name | 1-fluoro-2-nitro-4-phenylmethoxybenzene |
| InChIKey | FWBDUAPLKFBELK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)