CAS 433226-25-6 is the registry number for 2-(Benzyloxy)-1-fluoro-4-nitrobenzene, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
1-fluoro-4-nitro-2-phenylmethoxybenzene (CAS 433226-25-6) is a chemical compound with the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. IUPAC name: 1-fluoro-4-nitro-2-phenylmethoxybenzene. InChIKey: LAUAOGSIUWTVEZ-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO3 |
|---|---|
| Molecular weight | 247.22 g/mol |
| IUPAC name | 1-fluoro-4-nitro-2-phenylmethoxybenzene |
| InChIKey | LAUAOGSIUWTVEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)