CAS 370864-61-2 is the registry number for 2-Fluoro-4-(6-methoxypyridin-3-yl)benzoic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-fluoro-4-(6-methoxy-3-pyridinyl)benzoic acid (CAS 370864-61-2) is a chemical compound with the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. IUPAC name: 2-fluoro-4-(6-methoxy-3-pyridinyl)benzoic acid. InChIKey: KWZDUJBEZOVBRB-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO3 |
|---|---|
| Molecular weight | 247.22 g/mol |
| IUPAC name | 2-fluoro-4-(6-methoxy-3-pyridinyl)benzoic acid |
| InChIKey | KWZDUJBEZOVBRB-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)