cas: 6633-22-3 — see every product listed under this CAS number, including other names
1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione, 98%, 98% (CAS 6633-22-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAOL-50mg |
| cas | 6633-22-3 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 126.80 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1168.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-fluorophenyl)pyrrole-2,5-dione (CAS 6633-22-3) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 1-(4-fluorophenyl)pyrrole-2,5-dione. InChIKey: SBKKXWSZVVDOLR-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 1-(4-fluorophenyl)pyrrole-2,5-dione |
| InChIKey | SBKKXWSZVVDOLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)F |
Computed by PubChem (NCBI)