cas: 37592-72-6 — see every product listed under this CAS number, including other names
1-(4-Hexylphenyl)ethanone, 98% (CAS 37592-72-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329902-1G |
| cas | 37592-72-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 25g | 721.64 Pln | |
| Fluorochem | 100g | 2668.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-hexylphenyl)ethanone (CAS 37592-72-6) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 1-(4-hexylphenyl)ethanone. InChIKey: WWBVHJKFJZBRSO-UHFFFAOYSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 1-(4-hexylphenyl)ethanone |
| InChIKey | WWBVHJKFJZBRSO-UHFFFAOYSA-N |
| SMILES | CCCCCCC1=CC=C(C=C1)C(=O)C |
Computed by PubChem (NCBI)