cas: 37592-72-6 — see every product listed under this CAS number, including other names
4'–Hexylacetophenone (CAS 37592-72-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 2g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD14477-10g |
| cas | 37592-72-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 746.82 Pln | |
| GLPBio | 25g | 882.55 Pln | |
| GLPBio | 2g | 531.51 Pln | |
| GLPBio | 5g | 606.40 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(4-hexylphenyl)ethanone (CAS 37592-72-6) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 1-(4-hexylphenyl)ethanone. InChIKey: WWBVHJKFJZBRSO-UHFFFAOYSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 1-(4-hexylphenyl)ethanone |
| InChIKey | WWBVHJKFJZBRSO-UHFFFAOYSA-N |
| SMILES | CCCCCCC1=CC=C(C=C1)C(=O)C |
Computed by PubChem (NCBI)