cas: 37592-72-6 — see every product listed under this CAS number, including other names
4'-Hexylacetophenone, >96.0%(GC) (CAS 37592-72-6) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H0669-25G |
| cas | 37592-72-6 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 610.07 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC) |
1-(4-hexylphenyl)ethanone (CAS 37592-72-6) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 1-(4-hexylphenyl)ethanone. InChIKey: WWBVHJKFJZBRSO-UHFFFAOYSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 1-(4-hexylphenyl)ethanone |
| InChIKey | WWBVHJKFJZBRSO-UHFFFAOYSA-N |
| SMILES | CCCCCCC1=CC=C(C=C1)C(=O)C |
Computed by PubChem (NCBI)