cas: 17452-14-1 — see every product listed under this CAS number, including other names
1-(4-Methoxyphenyl)imidazoline-2-thione (CAS 17452-14-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018800-250MG |
| cas | 17452-14-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 502.97 Pln |
| delivery time | 2-3 weeks |
|---|
3-(4-methoxyphenyl)-1H-imidazole-2-thione (CAS 17452-14-1) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 3-(4-methoxyphenyl)-1H-imidazole-2-thione. InChIKey: LIEBCNQPMNARMP-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-1H-imidazole-2-thione |
| InChIKey | LIEBCNQPMNARMP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C=CNC2=S |
Computed by PubChem (NCBI)