CAS 94830-63-4 appears in our catalog under these names: 4-(Phenoxymethyl)-1,3-thiazol-2-amine, 4-(Phenoxymethyl)-1,3-thiazol-2-amine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1g, 10g, 5g.
4-(phenoxymethyl)-1,3-thiazol-2-amine (CAS 94830-63-4) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 4-(phenoxymethyl)-1,3-thiazol-2-amine. InChIKey: OAQVZJWKWGNLRJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 4-(phenoxymethyl)-1,3-thiazol-2-amine |
| InChIKey | OAQVZJWKWGNLRJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=CSC(=N2)N |
Computed by PubChem (NCBI)