CAS 142230-96-4 appears in our catalog under these names: 2,5-Dimethyl-1-(1,3-thiazol-2-yl)-1h-pyrrole-3-carbaldehyde, 95%, 2,5-Dimethyl-1-thiazol-2-yl-1H-pyrrole-3-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 0,5g.
2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carbaldehyde (CAS 142230-96-4) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carbaldehyde. InChIKey: POOXCXKWGLDXNJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrole-3-carbaldehyde |
| InChIKey | POOXCXKWGLDXNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=NC=CS2)C)C=O |
Computed by PubChem (NCBI)