CAS 17385-68-1 appears in our catalog under these names: 2-P-Tolylamino-thiazol-4-one, 95%, 2-((4-Methylphenyl)amino)-4,5-dihydro-1,3-thiazol-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (CAS 17385-68-1) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 2-(4-methylphenyl)imino-1,3-thiazolidin-4-one. InChIKey: LWRUIMYWCYBHAP-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| InChIKey | LWRUIMYWCYBHAP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N=C2NC(=O)CS2 |
Computed by PubChem (NCBI)