CAS 108413-56-5 is the registry number for 5-(3,4-Dimethylphenyl)-1,3,4-oxadiazole-2-thiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
5-(3,4-dimethylphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 108413-56-5) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 5-(3,4-dimethylphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: ZKMQIPCAKYEHCX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 5-(3,4-dimethylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | ZKMQIPCAKYEHCX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NNC(=S)O2)C |
Computed by PubChem (NCBI)