cas: 39910-98-0 — see every product listed under this CAS number, including other names
1-(4-Morpholinophenyl)ethanone, 98% (CAS 39910-98-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222949-5G |
| cas | 39910-98-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 357.18 Pln | |
| Fluorochem | 100g | 1049.65 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-morpholin-4-ylphenyl)ethanone (CAS 39910-98-0) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 1-(4-morpholin-4-ylphenyl)ethanone. InChIKey: AKQWEDMTPCAESO-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 1-(4-morpholin-4-ylphenyl)ethanone |
| InChIKey | AKQWEDMTPCAESO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2CCOCC2 |
Computed by PubChem (NCBI)