cas: 39910-98-0 — see every product listed under this CAS number, including other names
4-Morpholinoacetophenone, 99% (CAS 39910-98-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 152900050 |
| cas | 39910-98-0 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 176.84 Pln | |
| Thermo Scientific (Acros) | 50g | 1189.34 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
1-(4-morpholin-4-ylphenyl)ethanone (CAS 39910-98-0) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 1-(4-morpholin-4-ylphenyl)ethanone. InChIKey: AKQWEDMTPCAESO-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 1-(4-morpholin-4-ylphenyl)ethanone |
| InChIKey | AKQWEDMTPCAESO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2CCOCC2 |
Computed by PubChem (NCBI)