cas: 260252-87-7 — see every product listed under this CAS number, including other names
1-(4-NITROPHENYL)PIPERAZINE HCL, 95% (CAS 260252-87-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F527238-1G |
| cas | 260252-87-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 763.29 Pln | |
| Fluorochem | 100g | 1903.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-nitrophenyl)piperazine;hydrochloride (CAS 260252-87-7) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: 1-(4-nitrophenyl)piperazine;hydrochloride. InChIKey: QRQYCCQVGRORKX-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 1-(4-nitrophenyl)piperazine;hydrochloride |
| InChIKey | QRQYCCQVGRORKX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)