CAS 139264-57-6 appears in our catalog under these names: Zolmitriptan Impurity 1 HCl, (S)-4-(4-Hydrazinobenzyl)-2-oxazolidinone Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
(4S)-4-[(4-hydrazinylphenyl)methyl]-1,3-oxazolidin-2-one;hydrochloride (CAS 139264-57-6) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: (4S)-4-[(4-hydrazinylphenyl)methyl]-1,3-oxazolidin-2-one;hydrochloride. InChIKey: ANOPNEVQPPHZLO-FVGYRXGTSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | (4S)-4-[(4-hydrazinylphenyl)methyl]-1,3-oxazolidin-2-one;hydrochloride |
| InChIKey | ANOPNEVQPPHZLO-FVGYRXGTSA-N |
| SMILES | C1[C@@H](NC(=O)O1)CC2=CC=C(C=C2)NN.Cl |
Computed by PubChem (NCBI)