cas: 260252-87-7 — see every product listed under this CAS number, including other names
1-(4-Nitrophenyl)Piperazine Hydrochloride, 95%, 95% (CAS 260252-87-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C4Z0-1g |
| cas | 260252-87-7 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 100g | 1163.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-nitrophenyl)piperazine;hydrochloride (CAS 260252-87-7) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: 1-(4-nitrophenyl)piperazine;hydrochloride. InChIKey: QRQYCCQVGRORKX-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 1-(4-nitrophenyl)piperazine;hydrochloride |
| InChIKey | QRQYCCQVGRORKX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)