cas: 91552-71-5 — see every product listed under this CAS number, including other names
1-(4-tert-Butylphenyl)ethanamine HCl, 98%, 98% (CAS 91552-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGRB-100mg |
| cas | 91552-71-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 582.80 Pln | |
| Chemat | 5g | 1859.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-tert-butylphenyl)ethanamine;hydrochloride (CAS 91552-71-5) is a chemical compound with the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. IUPAC name: 1-(4-tert-butylphenyl)ethanamine;hydrochloride. InChIKey: WQCMEXXHUOHNLP-UHFFFAOYSA-N.
| Molecular formula | C12H20ClN |
|---|---|
| Molecular weight | 213.75 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)ethanamine;hydrochloride |
| InChIKey | WQCMEXXHUOHNLP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)