CAS 1415303-39-7 appears in our catalog under these names: (1S)-1-(4-tert-Butylphenyl)ethan-1-amine hydrochloride, 95%, (S)–1–(4–(tert–butyl)phenyl)ethan–1–amine hcl, (1S)-1-(4-tert-Butylphenyl)ethan-1-amine hydrochloride, (S)-1-(4-(tert-Butyl)phenyl)ethan-1-amine hydrochloride 95%, (1S)-1-(4-tert-butylphenyl)ethan-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 0,5g, 10g, 500mg, 2.5g.
(1S)-1-(4-tert-butylphenyl)ethanamine;hydrochloride (CAS 1415303-39-7) is a chemical compound with the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. IUPAC name: (1S)-1-(4-tert-butylphenyl)ethanamine;hydrochloride. InChIKey: WQCMEXXHUOHNLP-FVGYRXGTSA-N.
| Molecular formula | C12H20ClN |
|---|---|
| Molecular weight | 213.75 g/mol |
| IUPAC name | (1S)-1-(4-tert-butylphenyl)ethanamine;hydrochloride |
| InChIKey | WQCMEXXHUOHNLP-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)