CAS 7430-15-1 is the registry number for Phenyltriethylammonium chloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Triethyl(phenyl)azanium chloride (CAS 7430-15-1) is a chemical compound with the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. IUPAC name: triethyl(phenyl)azanium chloride. InChIKey: ICTMDIORIDZWQN-UHFFFAOYSA-M.
| Molecular formula | C12H20ClN |
|---|---|
| Molecular weight | 213.75 g/mol |
| IUPAC name | triethyl(phenyl)azanium chloride |
| InChIKey | ICTMDIORIDZWQN-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)C1=CC=CC=C1.[Cl-] |
Computed by PubChem (NCBI)