CAS 1291486-03-7 appears in our catalog under these names: (3-Chloro-1-adamantyl)dimethylamine hydrochloride, 95%, 3-Chloro-N,N-dimethyladamantan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-chloro-N,N-dimethyladamantan-1-amine (CAS 1291486-03-7) is a chemical compound with the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. IUPAC name: 3-chloro-N,N-dimethyladamantan-1-amine. InChIKey: PXWWJPYCWJIXCB-UHFFFAOYSA-N.
| Molecular formula | C12H20ClN |
|---|---|
| Molecular weight | 213.75 g/mol |
| IUPAC name | 3-chloro-N,N-dimethyladamantan-1-amine |
| InChIKey | PXWWJPYCWJIXCB-UHFFFAOYSA-N |
| SMILES | CN(C)C12CC3CC(C1)CC(C3)(C2)Cl |
Computed by PubChem (NCBI)